C32H40N4O3 — CID 10208622
(2S)-2-[(3S)-4-[[4-(dimethylamino)phenyl]methyl]-3-(2-methylpropyl)-2,5-dioxo-1,4-diazepan-1-yl]-N-methyl-3-naphthalen-2-ylpropanamide (PubChem CID 10208622) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is (2S)-2-[(3S)-4-[[4-(dimethylamino)phenyl]methyl]-3-(2-methylpropyl)-2,5-dioxo-1,4-diazepan-1-yl]-N-methyl-3-naphthalen-2-ylpropanamide.
| Compound Name | (2S)-2-[(3S)-4-[[4-(dimethylamino)phenyl]methyl]-3-(2-methylpropyl)-2,5-dioxo-1,4-diazepan-1-yl]-N-methyl-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 10208622 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | (2S)-2-[(3S)-4-[[4-(dimethylamino)phenyl]methyl]-3-(2-methylpropyl)-2,5-dioxo-1,4-diazepan-1-yl]-N-methyl-3-naphthalen-2-ylpropanamide |
| SMILES | CNC(=O)[C@H](Cc1ccc2ccccc2c1)N1CCC(=O)N(Cc2ccc(N(C)C)cc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C32H40N4O3/c1-22(2)18-29-32(39)35(17-16-30(37)36(29)21-23-11-14-27(15-12-23)34(4)5)28(31(38)33-3)20-24-10-13-25-8-6-7-9-26(25)19-24/h6-15,19,22,28-29H,16-18,20-21H2,1-5H3,(H,33,38)/t28-,29-/m0/s1 |
| InChIKey | VHWHPFQFPMRDDY-VMPREFPWSA-N |
| XLogP | 4.24 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|