C31H47NO6 — CID 10208670
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[4-methoxy-3,5-di(propan-2-yl)anilino]acetate (PubChem CID 10208670) has the molecular formula C31H47NO6 and a molecular weight of 529.72 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[4-methoxy-3,5-di(propan-2-yl)anilino]acetate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[4-methoxy-3,5-di(propan-2-yl)anilino]acetate |
|---|---|
| PubChem CID | 10208670 |
| Molecular Formula | C31H47NO6 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[4-methoxy-3,5-di(propan-2-yl)anilino]acetate |
| SMILES | COc1c(C(C)C)cc(NCC(=O)O[C@@H]2CC[C@]3(CO3)[C@@H]([C@]3(C)O[C@@H]3CC=C(C)C)[C@@H]2OC)cc1C(C)C |
| InChI | InChI=1S/C31H47NO6/c1-18(2)10-11-25-30(7,38-25)29-28(35-9)24(12-13-31(29)17-36-31)37-26(33)16-32-21-14-22(19(3)4)27(34-8)23(15-21)20(5)6/h10,14-15,19-20,24-25,28-29,32H,11-13,16-17H2,1-9H3/t24-,25-,28-,29-,30-,31+/m1/s1 |
| InChIKey | DTFXFGHRLLCBGV-IJNOHRERSA-N |
| XLogP | 5.97 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|