C9H14N2O5S2 — CID 102087148
(4aS,6R,7S,8R,8aR)-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-sulfanylidene-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one (PubChem CID 102087148) has the molecular formula C9H14N2O5S2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (4aS,6R,7S,8R,8aR)-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-sulfanylidene-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one.
| Compound Name | (4aS,6R,7S,8R,8aR)-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-sulfanylidene-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102087148 |
| Molecular Formula | C9H14N2O5S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (4aS,6R,7S,8R,8aR)-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-sulfanylidene-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one |
| SMILES | O=C1NC(=S)N[C@@H]2[C@@H](O)[C@H](O)[C@@H]([C@H](O)CO)S[C@H]12 |
| InChI | InChI=1S/C9H14N2O5S2/c12-1-2(13)6-5(15)4(14)3-7(18-6)8(16)11-9(17)10-3/h2-7,12-15H,1H2,(H2,10,11,16,17)/t2-,3-,4-,5+,6-,7+/m1/s1 |
| InChIKey | YKFQBUVAIHXQGT-VXGWJHEQSA-N |
| XLogP | -3.08 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|