C21H28NO4P — CID 102087222
(2R,3S)-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)-3-phenylaziridine (PubChem CID 102087222) has the molecular formula C21H28NO4P and a molecular weight of 389.43 g/mol. Its IUPAC name is (2R,3S)-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)-3-phenylaziridine.
| Compound Name | (2R,3S)-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)-3-phenylaziridine |
|---|---|
| PubChem CID | 102087222 |
| Molecular Formula | C21H28NO4P |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2R,3S)-2-di(propan-2-yloxy)phosphoryl-1-(4-methoxyphenyl)-3-phenylaziridine |
| SMILES | COc1ccc(N2[C@H](P(=O)(OC(C)C)OC(C)C)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28NO4P/c1-15(2)25-27(23,26-16(3)4)21-20(17-9-7-6-8-10-17)22(21)18-11-13-19(24-5)14-12-18/h6-16,20-21H,1-5H3/t20-,21+,22?/m0/s1 |
| InChIKey | TVKOCQUOAWRWCV-UGGDCYSXSA-N |
| XLogP | 5.63 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|