C14H2F18O2 — CID 102087478
2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 102087478) has the molecular formula C14H2F18O2 and a molecular weight of 544.13 g/mol. Its IUPAC name is 2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102087478 |
| Molecular Formula | C14H2F18O2 |
| Molecular Weight | 544.13 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | 2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)C=C1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H2F18O2/c15-7(16,9(19,20)11(23,24)13(27,28)29)3-1-5(33)4(2-6(3)34)8(17,18)10(21,22)12(25,26)14(30,31)32/h1-2H |
| InChIKey | QXNGOMTXXFSJJZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.13 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|