C13H18O7 — CID 102087501
dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate (PubChem CID 102087501) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate.
| Compound Name | dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate |
|---|---|
| PubChem CID | 102087501 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate |
| SMILES | CCOC(=O)C(=O)CC1(C(C(=O)OC)C(=O)OC)CC1 |
| InChI | InChI=1S/C13H18O7/c1-4-20-10(15)8(14)7-13(5-6-13)9(11(16)18-2)12(17)19-3/h9H,4-7H2,1-3H3 |
| InChIKey | KMUPWILRLYNHHI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|