About dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate
dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate (PubChem CID 102087501) has the molecular formula C13H18O7
and a molecular weight of 286.28 g/mol. Its IUPAC name is dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate |
| PubChem CID | 102087501 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate |
| SMILES | CCOC(=O)C(=O)CC1(C(C(=O)OC)C(=O)OC)CC1 |
| InChI | InChI=1S/C13H18O7/c1-4-20-10(15)8(14)7-13(5-6-13)9(11(16)18-2)12(17)19-3/h9H,4-7H2,1-3H3 |
| InChIKey | KMUPWILRLYNHHI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate?
The IUPAC name of dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate (CID 102087501) is dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate.
What is the SMILES notation for dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate?
The canonical SMILES for dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate is CCOC(=O)C(=O)CC1(C(C(=O)OC)C(=O)OC)CC1.
What is the InChIKey of dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate?
The InChIKey is KMUPWILRLYNHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O7/c1-4-20-10(15)8(14)7-13(5-6-13)9(11(16)18-2)12(17)19-3/h9H,4-7H2,1-3H3.
What are the key properties of dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate?
dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate has a molecular weight of 286.28 g/mol, XLogP of 0.25, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[1-(3-ethoxy-2,3-dioxopropyl)cyclopropyl]propanedioate is sourced from PubChem (CID 102087501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).