C20H31ClO4 — CID 102087856
(1R,5aR,6S,7S,9S,9aS,9bS)-7-chloro-6-(3-hydroxy-4-methylpent-4-enyl)-6,9a-dimethyl-1,3,5,5a,7,8,9,9b-octahydrobenzo[g][2]benzofuran-1,9-diol (PubChem CID 102087856) has the molecular formula C20H31ClO4 and a molecular weight of 370.92 g/mol. Its IUPAC name is (1R,5aR,6S,7S,9S,9aS,9bS)-7-chloro-6-(3-hydroxy-4-methylpent-4-enyl)-6,9a-dimethyl-1,3,5,5a,7,8,9,9b-octahydrobenzo[g][2]benzofuran-1,9-diol.
| Compound Name | (1R,5aR,6S,7S,9S,9aS,9bS)-7-chloro-6-(3-hydroxy-4-methylpent-4-enyl)-6,9a-dimethyl-1,3,5,5a,7,8,9,9b-octahydrobenzo[g][2]benzofuran-1,9-diol |
|---|---|
| PubChem CID | 102087856 |
| Molecular Formula | C20H31ClO4 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1R,5aR,6S,7S,9S,9aS,9bS)-7-chloro-6-(3-hydroxy-4-methylpent-4-enyl)-6,9a-dimethyl-1,3,5,5a,7,8,9,9b-octahydrobenzo[g][2]benzofuran-1,9-diol |
| SMILES | C=C(C)C(O)CC[C@]1(C)[C@@H](Cl)C[C@H](O)[C@]2(C)[C@@H]3C(=CC[C@@H]12)CO[C@H]3O |
| InChI | InChI=1S/C20H31ClO4/c1-11(2)13(22)7-8-19(3)14-6-5-12-10-25-18(24)17(12)20(14,4)16(23)9-15(19)21/h5,13-18,22-24H,1,6-10H2,2-4H3/t13?,14-,15-,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | OEHHQEMJHDYXHN-NHTFSTGMSA-N |
| XLogP | 3.00 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|