About CID 102088109
CID 102088109 (PubChem CID 102088109) has the molecular formula C7H9O
and a molecular weight of 109.15 g/mol.
Molecular Properties
| Compound Name | CID 102088109 |
| PubChem CID | 102088109 |
| Molecular Formula | C7H9O |
| Molecular Weight | 109.15 g/mol |
| Exact Mass | 109.07 |
| IUPAC Name | — |
| SMILES | CC1=C[C@@H](O)[CH]C=C1 |
| InChI | InChI=1S/C7H9O/c1-6-3-2-4-7(8)5-6/h2-5,7-8H,1H3/t7-/m0/s1 |
| InChIKey | LXMIGCBGLVFSAG-ZETCQYMHSA-N |
| XLogP | 1.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 102088109 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102088109?
The IUPAC name of CID 102088109 (CID 102088109) is not available.
What is the SMILES notation for CID 102088109?
The canonical SMILES for CID 102088109 is CC1=C[C@@H](O)[CH]C=C1.
What is the InChIKey of CID 102088109?
The InChIKey is LXMIGCBGLVFSAG-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H9O/c1-6-3-2-4-7(8)5-6/h2-5,7-8H,1H3/t7-/m0/s1.
What are the key properties of CID 102088109?
CID 102088109 has a molecular weight of 109.15 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102088109 is sourced from PubChem (CID 102088109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).