C11H12N2O3 — CID 102088123
3-ethoxy-4-phenyl-4,5-dihydro-1,2,5-oxadiazin-6-one (PubChem CID 102088123) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-ethoxy-4-phenyl-4,5-dihydro-1,2,5-oxadiazin-6-one.
| Compound Name | 3-ethoxy-4-phenyl-4,5-dihydro-1,2,5-oxadiazin-6-one |
|---|---|
| PubChem CID | 102088123 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-ethoxy-4-phenyl-4,5-dihydro-1,2,5-oxadiazin-6-one |
| SMILES | CCOC1=NOC(=O)NC1c1ccccc1 |
| InChI | InChI=1S/C11H12N2O3/c1-2-15-10-9(12-11(14)16-13-10)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,14) |
| InChIKey | JJFAMDCRVIVYEA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|