C27H28N6O — CID 102088447
(2S)-2-[bis(pyridin-2-ylmethyl)amino]-N,N-bis(pyridin-2-ylmethyl)propanamide (PubChem CID 102088447) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is (2S)-2-[bis(pyridin-2-ylmethyl)amino]-N,N-bis(pyridin-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[bis(pyridin-2-ylmethyl)amino]-N,N-bis(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 102088447 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (2S)-2-[bis(pyridin-2-ylmethyl)amino]-N,N-bis(pyridin-2-ylmethyl)propanamide |
| SMILES | C[C@@H](C(=O)N(Cc1ccccn1)Cc1ccccn1)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C27H28N6O/c1-22(32(18-23-10-2-6-14-28-23)19-24-11-3-7-15-29-24)27(34)33(20-25-12-4-8-16-30-25)21-26-13-5-9-17-31-26/h2-17,22H,18-21H2,1H3/t22-/m0/s1 |
| InChIKey | FPTZENDHGZFUCH-QFIPXVFZSA-N |
| XLogP | 3.89 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |