C26H52O3Si2 — CID 102088558
(4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,11-dimethyldodeca-6,10-dienal (PubChem CID 102088558) has the molecular formula C26H52O3Si2 and a molecular weight of 468.87 g/mol. Its IUPAC name is (4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,11-dimethyldodeca-6,10-dienal.
| Compound Name | (4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,11-dimethyldodeca-6,10-dienal |
|---|---|
| PubChem CID | 102088558 |
| Molecular Formula | C26H52O3Si2 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | (4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,11-dimethyldodeca-6,10-dienal |
| SMILES | CC(C)=CCC/C(C)=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O3Si2/c1-21(2)16-14-17-22(3)20-24(29-31(12,13)26(7,8)9)23(18-15-19-27)28-30(10,11)25(4,5)6/h16,19-20,23-24H,14-15,17-18H2,1-13H3/b22-20+/t23-,24-/m1/s1 |
| InChIKey | REJVSCRWGYBCFL-APRKTMJDSA-N |
| XLogP | 8.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|