C28H58O3Si2 — CID 102089057
tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane (PubChem CID 102089057) has the molecular formula C28H58O3Si2 and a molecular weight of 498.94 g/mol. Its IUPAC name is tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102089057 |
| Molecular Formula | C28H58O3Si2 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane |
| SMILES | CC(C)C/C=C/[C@@H](C[C@@H]1CC[C@H](C)[C@@H](CCO[Si](C)(C)C(C)(C)C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O3Si2/c1-22(2)15-14-16-25(31-33(12,13)28(7,8)9)21-24-18-17-23(3)26(30-24)19-20-29-32(10,11)27(4,5)6/h14,16,22-26H,15,17-21H2,1-13H3/b16-14+/t23-,24-,25-,26+/m0/s1 |
| InChIKey | WMBZDWGYFFZNNP-DZAJDTOQSA-N |
| XLogP | 8.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|