C22H35NOSi — CID 102089525
tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-dimethylsilane (PubChem CID 102089525) has the molecular formula C22H35NOSi and a molecular weight of 357.61 g/mol. Its IUPAC name is tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102089525 |
| Molecular Formula | C22H35NOSi |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](/C=C/c2ccccc2)N1C |
| InChI | InChI=1S/C22H35NOSi/c1-8-19-16-21(24-25(6,7)22(2,3)4)17-20(23(19)5)15-14-18-12-10-9-11-13-18/h8-15,19-21H,1,16-17H2,2-7H3/b15-14+/t19-,20+,21+/m0/s1 |
| InChIKey | RURJBWHYVXENOD-NRSPHGDISA-N |
| XLogP | 5.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|