C14H23NO — CID 102089569
(2R)-2-pentyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one (PubChem CID 102089569) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (2R)-2-pentyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one.
| Compound Name | (2R)-2-pentyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one |
|---|---|
| PubChem CID | 102089569 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2R)-2-pentyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one |
| SMILES | CCCCC[C@@H]1CCC2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C14H23NO/c1-2-3-4-6-11-9-10-12-13(15-11)7-5-8-14(12)16/h11,15H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | YUNZGZKQTBEGGV-LLVKDONJSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|