C12H9F13O2 — CID 102089595
ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-2-enoate (PubChem CID 102089595) has the molecular formula C12H9F13O2 and a molecular weight of 432.18 g/mol. Its IUPAC name is ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-2-enoate.
| Compound Name | ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-2-enoate |
|---|---|
| PubChem CID | 102089595 |
| Molecular Formula | C12H9F13O2 |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | ethyl (E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F13O2/c1-3-27-6(26)4-5(2)7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h4H,3H2,1-2H3/b5-4+ |
| InChIKey | HBGFUJHDMHRLJZ-SNAWJCMRSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|