C31H53N3O6Si — CID 102089672
(4R,6S,7R,8S,11R,13S)-14-azido-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,11,13-trimethyltetradecane-2,10-dione (PubChem CID 102089672) has the molecular formula C31H53N3O6Si and a molecular weight of 591.87 g/mol. Its IUPAC name is (4R,6S,7R,8S,11R,13S)-14-azido-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,11,13-trimethyltetradecane-2,10-dione.
| Compound Name | (4R,6S,7R,8S,11R,13S)-14-azido-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,11,13-trimethyltetradecane-2,10-dione |
|---|---|
| PubChem CID | 102089672 |
| Molecular Formula | C31H53N3O6Si |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.37 |
| IUPAC Name | (4R,6S,7R,8S,11R,13S)-14-azido-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,11,13-trimethyltetradecane-2,10-dione |
| SMILES | COc1ccc(CO[C@@H]([C@H](C[C@@H](C)CC(C)=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CC(=O)[C@H](C)C[C@H](C)CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C31H53N3O6Si/c1-21(16-24(4)35)17-29(40-41(9,10)31(5,6)7)30(39-20-25-11-13-26(38-8)14-12-25)28(37)18-27(36)23(3)15-22(2)19-33-34-32/h11-14,21-23,28-30,37H,15-20H2,1-10H3/t21-,22-,23+,28-,29-,30+/m0/s1 |
| InChIKey | QLFBENFEHZDCPB-WCFJWIPDSA-N |
| XLogP | 7.27 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|