C11H17NO4 — CID 102090055
ethyl (4aS,8S,8aR)-8-hydroxy-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine-3-carboxylate (PubChem CID 102090055) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl (4aS,8S,8aR)-8-hydroxy-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine-3-carboxylate.
| Compound Name | ethyl (4aS,8S,8aR)-8-hydroxy-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 102090055 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl (4aS,8S,8aR)-8-hydroxy-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine-3-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@@H]2[C@@H](CCC[C@@H]2O)C1 |
| InChI | InChI=1S/C11H17NO4/c1-2-15-11(14)8-6-7-4-3-5-9(13)10(7)16-12-8/h7,9-10,13H,2-6H2,1H3/t7-,9-,10+/m0/s1 |
| InChIKey | VGRQQZMSZYSNAY-UJNFCWOMSA-N |
| XLogP | 0.86 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |