C19H18O3S — CID 102090216
7-methyl-3-phenylsulfanyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-5-one (PubChem CID 102090216) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 7-methyl-3-phenylsulfanyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-5-one.
| Compound Name | 7-methyl-3-phenylsulfanyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 102090216 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 7-methyl-3-phenylsulfanyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-5-one |
| SMILES | Cc1cccc2c1OC(=O)C1CC(Sc3ccccc3)COC21 |
| InChI | InChI=1S/C19H18O3S/c1-12-6-5-9-15-17(12)22-19(20)16-10-14(11-21-18(15)16)23-13-7-3-2-4-8-13/h2-9,14,16,18H,10-11H2,1H3 |
| InChIKey | UICXWEXIWIPBIO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|