C15H10N2 — CID 102090566
2-[(2Z,5Z)-4-bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaenylidene]propanedinitrile (PubChem CID 102090566) has the molecular formula C15H10N2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[(2Z,5Z)-4-bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaenylidene]propanedinitrile.
| Compound Name | 2-[(2Z,5Z)-4-bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaenylidene]propanedinitrile |
|---|---|
| PubChem CID | 102090566 |
| Molecular Formula | C15H10N2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-[(2Z,5Z)-4-bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaenylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C=C\C2=CC=CC=C(/C=C\1)C2 |
| InChI | InChI=1S/C15H10N2/c16-10-15(11-17)14-7-5-12-3-1-2-4-13(9-12)6-8-14/h1-8H,9H2/b7-5-,8-6- |
| InChIKey | AZLKDINOJOASHU-SFECMWDFSA-N |
| XLogP | 3.27 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|