C12H15NO3 — CID 102090862
(8S,8aR)-8a-methylspiro[2,5,6,7-tetrahydro-1H-indolizine-8,5'-furan]-2',3-dione (PubChem CID 102090862) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (8S,8aR)-8a-methylspiro[2,5,6,7-tetrahydro-1H-indolizine-8,5'-furan]-2',3-dione.
| Compound Name | (8S,8aR)-8a-methylspiro[2,5,6,7-tetrahydro-1H-indolizine-8,5'-furan]-2',3-dione |
|---|---|
| PubChem CID | 102090862 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (8S,8aR)-8a-methylspiro[2,5,6,7-tetrahydro-1H-indolizine-8,5'-furan]-2',3-dione |
| SMILES | C[C@]12CCC(=O)N1CCC[C@]21C=CC(=O)O1 |
| InChI | InChI=1S/C12H15NO3/c1-11-6-3-9(14)13(11)8-2-5-12(11)7-4-10(15)16-12/h4,7H,2-3,5-6,8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | UIHWFBROBQVRAI-NEPJUHHUSA-N |
| XLogP | 1.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |