C25H35NO — CID 102090894
5-[(2S,3R,4R,5R)-1-methyl-3,4-diphenyl-5-propan-2-ylpyrrolidin-2-yl]pentan-1-ol (PubChem CID 102090894) has the molecular formula C25H35NO and a molecular weight of 365.56 g/mol. Its IUPAC name is 5-[(2S,3R,4R,5R)-1-methyl-3,4-diphenyl-5-propan-2-ylpyrrolidin-2-yl]pentan-1-ol.
| Compound Name | 5-[(2S,3R,4R,5R)-1-methyl-3,4-diphenyl-5-propan-2-ylpyrrolidin-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 102090894 |
| Molecular Formula | C25H35NO |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | 5-[(2S,3R,4R,5R)-1-methyl-3,4-diphenyl-5-propan-2-ylpyrrolidin-2-yl]pentan-1-ol |
| SMILES | CC(C)[C@@H]1[C@@H](c2ccccc2)[C@H](c2ccccc2)[C@H](CCCCCO)N1C |
| InChI | InChI=1S/C25H35NO/c1-19(2)25-24(21-15-9-5-10-16-21)23(20-13-7-4-8-14-20)22(26(25)3)17-11-6-12-18-27/h4-5,7-10,13-16,19,22-25,27H,6,11-12,17-18H2,1-3H3/t22-,23+,24-,25+/m0/s1 |
| InChIKey | UFGALWXTCXXZQF-FQUZAXHOSA-N |
| XLogP | 5.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|