About 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine
1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine (PubChem CID 102091182) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine.
Molecular Properties
| Compound Name | 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine |
| PubChem CID | 102091182 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine |
| SMILES | C=C(/C=C/C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C14H24N2/c1-13(16-11-9-15-10-12-16)7-8-14-5-3-2-4-6-14/h7-8,14-15H,1-6,9-12H2/b8-7+ |
| InChIKey | SFFQLEZRCSLOMO-BQYQJAHWSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine?
The IUPAC name of 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine (CID 102091182) is 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine.
What is the SMILES notation for 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine?
The canonical SMILES for 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine is C=C(/C=C/C1CCCCC1)N1CCNCC1.
What is the InChIKey of 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine?
The InChIKey is SFFQLEZRCSLOMO-BQYQJAHWSA-N. The full InChI is InChI=1S/C14H24N2/c1-13(16-11-9-15-10-12-16)7-8-14-5-3-2-4-6-14/h7-8,14-15H,1-6,9-12H2/b8-7+.
What are the key properties of 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine?
1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine has a molecular weight of 220.36 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]piperazine is sourced from PubChem (CID 102091182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).