C10H11FO3 — CID 102091522
(1R,2R,3S,4S)-4-fluoro-1,2,3,4-tetrahydronaphthalene-1,2,3-triol (PubChem CID 102091522) has the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. Its IUPAC name is (1R,2R,3S,4S)-4-fluoro-1,2,3,4-tetrahydronaphthalene-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S)-4-fluoro-1,2,3,4-tetrahydronaphthalene-1,2,3-triol |
|---|---|
| PubChem CID | 102091522 |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (1R,2R,3S,4S)-4-fluoro-1,2,3,4-tetrahydronaphthalene-1,2,3-triol |
| SMILES | O[C@H]1[C@H](O)[C@@H](F)c2ccccc2[C@H]1O |
| InChI | InChI=1S/C10H11FO3/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-4,7-10,12-14H/t7-,8+,9+,10+/m0/s1 |
| InChIKey | PWJIESNRYDGJFM-SGIHWFKDSA-N |
| XLogP | 0.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |