About (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid
(E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 102092026) has the molecular formula C20H30O3
and a molecular weight of 318.46 g/mol. Its IUPAC name is (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
Molecular Properties
| Compound Name | (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| PubChem CID | 102092026 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CCCCC/C=C/C[C@@H]1C=CC(=O)[C@@H]1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-9-12-17-15-16-19(21)18(17)13-10-7-8-11-14-20(22)23/h6-7,9-10,15-18H,2-5,8,11-14H2,1H3,(H,22,23)/b9-6+,10-7+/t17-,18-/m1/s1 |
| InChIKey | KRSYJESLBARMQB-AHGIBZPUSA-N |
| XLogP | 5.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid?
The IUPAC name of (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (CID 102092026) is (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
What is the SMILES notation for (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid?
The canonical SMILES for (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid is CCCCC/C=C/C[C@@H]1C=CC(=O)[C@@H]1C/C=C/CCCC(=O)O.
What is the InChIKey of (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid?
The InChIKey is KRSYJESLBARMQB-AHGIBZPUSA-N. The full InChI is InChI=1S/C20H30O3/c1-2-3-4-5-6-9-12-17-15-16-19(21)18(17)13-10-7-8-11-14-20(22)23/h6-7,9-10,15-18H,2-5,8,11-14H2,1H3,(H,22,23)/b9-6+,10-7+/t17-,18-/m1/s1.
What are the key properties of (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid?
(E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid has a molecular weight of 318.46 g/mol, XLogP of 5.09, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-[(1R,2R)-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid is sourced from PubChem (CID 102092026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).