C17H18N4O7 — CID 102092133
(2R,3R,4R)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentanoic acid (PubChem CID 102092133) has the molecular formula C17H18N4O7 and a molecular weight of 390.35 g/mol. Its IUPAC name is (2R,3R,4R)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentanoic acid.
| Compound Name | (2R,3R,4R)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentanoic acid |
|---|---|
| PubChem CID | 102092133 |
| Molecular Formula | C17H18N4O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2R,3R,4R)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentanoic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@@H](O)[C@@H](O)[C@@H](O)C(=O)O)c2cc1C |
| InChI | InChI=1S/C17H18N4O7/c1-6-3-8-9(4-7(6)2)21(5-10(22)12(23)13(24)16(26)27)14-11(18-8)15(25)20-17(28)19-14/h3-4,10,12-13,22-24H,5H2,1-2H3,(H,26,27)(H,20,25,28)/t10-,12-,13-/m1/s1 |
| InChIKey | ZHEHPTDHYQQKJR-RAIGVLPGSA-N |
| XLogP | -1.63 |
| TPSA | 178.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|