C19H32O4Si — CID 102092269
tert-butyl-dimethyl-[[(1R,2R,6S,8R,9S)-12-methylidene-3-prop-1-en-2-yl-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]silane (PubChem CID 102092269) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,6S,8R,9S)-12-methylidene-3-prop-1-en-2-yl-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,6S,8R,9S)-12-methylidene-3-prop-1-en-2-yl-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]silane |
|---|---|
| PubChem CID | 102092269 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,6S,8R,9S)-12-methylidene-3-prop-1-en-2-yl-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]silane |
| SMILES | C=C(C)C1CO[C@H]2O[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3OCC(=C)[C@H]3[C@@H]12 |
| InChI | InChI=1S/C19H32O4Si/c1-11(2)13-10-21-17-15(13)14-12(3)9-20-16(14)18(22-17)23-24(7,8)19(4,5)6/h13-18H,1,3,9-10H2,2,4-8H3/t13?,14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | NJCYWYADLMFWPK-UUFBZVRBSA-N |
| XLogP | 4.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|