C16H19NO — CID 102092381
2-[(1R,8S)-2-methylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]-1-phenylethanone (PubChem CID 102092381) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[(1R,8S)-2-methylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]-1-phenylethanone.
| Compound Name | 2-[(1R,8S)-2-methylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 102092381 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[(1R,8S)-2-methylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]-1-phenylethanone |
| SMILES | C=C1CN2CCC[C@H]2[C@@H]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO/c1-12-11-17-9-5-8-15(17)14(12)10-16(18)13-6-3-2-4-7-13/h2-4,6-7,14-15H,1,5,8-11H2/t14-,15+/m1/s1 |
| InChIKey | ZIPOPYYSFRGKLI-CABCVRRESA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|