C17H17Br2NO3Te — CID 102092633
2,10-dibromo-6-propan-2-yloxy-12,14-dihydro-[1,2,3]benzoxatellurazino[2,3-b][1,2,3]benzoxatellurazine (PubChem CID 102092633) has the molecular formula C17H17Br2NO3Te and a molecular weight of 570.74 g/mol. Its IUPAC name is 2,10-dibromo-6-propan-2-yloxy-12,14-dihydro-[1,2,3]benzoxatellurazino[2,3-b][1,2,3]benzoxatellurazine.
| Compound Name | 2,10-dibromo-6-propan-2-yloxy-12,14-dihydro-[1,2,3]benzoxatellurazino[2,3-b][1,2,3]benzoxatellurazine |
|---|---|
| PubChem CID | 102092633 |
| Molecular Formula | C17H17Br2NO3Te |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.86 |
| IUPAC Name | 2,10-dibromo-6-propan-2-yloxy-12,14-dihydro-[1,2,3]benzoxatellurazino[2,3-b][1,2,3]benzoxatellurazine |
| SMILES | CC(C)O[Te]12Oc3ccc(Br)cc3CN1Cc1cc(Br)ccc1O2 |
| InChI | InChI=1S/C17H17Br2NO3Te/c1-11(2)21-24-20(9-12-7-14(18)3-5-16(12)22-24)10-13-8-15(19)4-6-17(13)23-24/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | SDYPYWMJAMYULK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|