C19H17F13IN — CID 102093058
3-(iodomethyl)-1-(4-methylphenyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyrrolidine (PubChem CID 102093058) has the molecular formula C19H17F13IN and a molecular weight of 633.23 g/mol. Its IUPAC name is 3-(iodomethyl)-1-(4-methylphenyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyrrolidine.
| Compound Name | 3-(iodomethyl)-1-(4-methylphenyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyrrolidine |
|---|---|
| PubChem CID | 102093058 |
| Molecular Formula | C19H17F13IN |
| Molecular Weight | 633.23 g/mol |
| Exact Mass | 633.02 |
| IUPAC Name | 3-(iodomethyl)-1-(4-methylphenyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyrrolidine |
| SMILES | Cc1ccc(N2CC(CI)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H17F13IN/c1-10-2-4-13(5-3-10)34-8-11(12(7-33)9-34)6-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h2-5,11-12H,6-9H2,1H3 |
| InChIKey | JXXSIDNSBJPBKA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.23 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|