C14H25F3O4Si — CID 102093229
(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 102093229) has the molecular formula C14H25F3O4Si and a molecular weight of 342.43 g/mol. Its IUPAC name is (2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 102093229 |
| Molecular Formula | C14H25F3O4Si |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C=C(C(F)(F)F)[C@H]1O |
| InChI | InChI=1S/C14H25F3O4Si/c1-13(2,3)22(5,6)20-8-9-7-10(14(15,16)17)11(18)12(19-4)21-9/h7,9,11-12,18H,8H2,1-6H3/t9-,11+,12-/m0/s1 |
| InChIKey | PIBMSKBDVLIBKK-WCQGTBRESA-N |
| XLogP | 3.23 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|