C29H42N2O6S — CID 10209327
[4-nitro-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate (PubChem CID 10209327) has the molecular formula C29H42N2O6S and a molecular weight of 546.73 g/mol. Its IUPAC name is [4-nitro-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate.
| Compound Name | [4-nitro-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate |
|---|---|
| PubChem CID | 10209327 |
| Molecular Formula | C29H42N2O6S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [4-nitro-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate |
| SMILES | CC(C)c1cc(C(C)C)c(CC(=O)NS(=O)(=O)Oc2c(C(C)C)cc([N+](=O)[O-])cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C29H42N2O6S/c1-16(2)21-11-23(17(3)4)27(24(12-21)18(5)6)15-28(32)30-38(35,36)37-29-25(19(7)8)13-22(31(33)34)14-26(29)20(9)10/h11-14,16-20H,15H2,1-10H3,(H,30,32) |
| InChIKey | XXZNSHPXCHTRKE-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|