About [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate
[4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate (PubChem CID 102093369) has the molecular formula C36H30O6
and a molecular weight of 558.63 g/mol. Its IUPAC name is [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate.
Molecular Properties
| Compound Name | [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate |
| PubChem CID | 102093369 |
| Molecular Formula | C36H30O6 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate |
| SMILES | C#CCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)c4ccc(OCCCC#C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H30O6/c1-3-5-7-25-39-31-17-13-29(14-18-31)35(37)41-33-21-9-27(10-22-33)28-11-23-34(24-12-28)42-36(38)30-15-19-32(20-16-30)40-26-8-6-4-2/h1-2,9-24H,5-8,25-26H2 |
| InChIKey | MLCVHKHLHJKDCY-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate?
The IUPAC name of [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate (CID 102093369) is [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate.
What is the SMILES notation for [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate?
The canonical SMILES for [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate is C#CCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)c4ccc(OCCCC#C)cc4)cc3)cc2)cc1.
What is the InChIKey of [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate?
The InChIKey is MLCVHKHLHJKDCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H30O6/c1-3-5-7-25-39-31-17-13-29(14-18-31)35(37)41-33-21-9-27(10-22-33)28-11-23-34(24-12-28)42-36(38)30-15-19-32(20-16-30)40-26-8-6-4-2/h1-2,9-24H,5-8,25-26H2.
What are the key properties of [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate?
[4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate has a molecular weight of 558.63 g/mol, XLogP of 7.38, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4-pent-4-ynoxybenzoyl)oxyphenyl]phenyl] 4-pent-4-ynoxybenzoate is sourced from PubChem (CID 102093369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).