C17H23NO3 — CID 102093381
[(1S,5R)-1,5-dimethyl-8-bicyclo[3.2.1]octanyl] N-(4-hydroxyphenyl)carbamate (PubChem CID 102093381) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [(1S,5R)-1,5-dimethyl-8-bicyclo[3.2.1]octanyl] N-(4-hydroxyphenyl)carbamate.
| Compound Name | [(1S,5R)-1,5-dimethyl-8-bicyclo[3.2.1]octanyl] N-(4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 102093381 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(1S,5R)-1,5-dimethyl-8-bicyclo[3.2.1]octanyl] N-(4-hydroxyphenyl)carbamate |
| SMILES | C[C@]12CCC[C@](C)(CC1)C2OC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-16-8-3-9-17(2,11-10-16)14(16)21-15(20)18-12-4-6-13(19)7-5-12/h4-7,14,19H,3,8-11H2,1-2H3,(H,18,20)/t14?,16-,17+ |
| InChIKey | BFMFVEQYPPZBSU-ZXFUBFMLSA-N |
| XLogP | 4.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|