About 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene
7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene (PubChem CID 102093635) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene.
Molecular Properties
| Compound Name | 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene |
| PubChem CID | 102093635 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene |
| SMILES | C=C1C(C)C2C=CC3(CCCC13)O2 |
| InChI | InChI=1S/C12H16O/c1-8-9(2)11-5-7-12(13-11)6-3-4-10(8)12/h5,7,9-11H,1,3-4,6H2,2H3 |
| InChIKey | UIPLFKWYVFQMTL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene?
The IUPAC name of 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene (CID 102093635) is 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene.
What is the SMILES notation for 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene?
The canonical SMILES for 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene is C=C1C(C)C2C=CC3(CCCC13)O2.
What is the InChIKey of 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene?
The InChIKey is UIPLFKWYVFQMTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-8-9(2)11-5-7-12(13-11)6-3-4-10(8)12/h5,7,9-11H,1,3-4,6H2,2H3.
What are the key properties of 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene?
7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene has a molecular weight of 176.26 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6-methylidene-11-oxatricyclo[6.2.1.01,5]undec-9-ene is sourced from PubChem (CID 102093635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).