C27H24F4N2O4S — CID 10209376
1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylpropan-1-ol (PubChem CID 10209376) has the molecular formula C27H24F4N2O4S and a molecular weight of 548.56 g/mol. Its IUPAC name is 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylpropan-1-ol.
| Compound Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 10209376 |
| Molecular Formula | C27H24F4N2O4S |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-phenylpropan-1-ol |
| SMILES | CCC(O)(c1ccccc1)c1ncc(C(Cc2cc[n+]([O-])cc2)c2ccc(OC(F)F)c(OC(F)F)c2)s1 |
| InChI | InChI=1S/C27H24F4N2O4S/c1-2-27(34,19-6-4-3-5-7-19)24-32-16-23(38-24)20(14-17-10-12-33(35)13-11-17)18-8-9-21(36-25(28)29)22(15-18)37-26(30)31/h3-13,15-16,20,25-26,34H,2,14H2,1H3 |
| InChIKey | MOXFXCFDRNXWIG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|