C17H23N3O4 — CID 102093881
(1R,10S,13S)-1-hydroxy-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione (PubChem CID 102093881) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is (1R,10S,13S)-1-hydroxy-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione.
| Compound Name | (1R,10S,13S)-1-hydroxy-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione |
|---|---|
| PubChem CID | 102093881 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (1R,10S,13S)-1-hydroxy-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](CO)C[C@]2(O)C(=O)Nc3cccc(c32)N1C |
| InChI | InChI=1S/C17H23N3O4/c1-9(2)14-15(22)18-10(8-21)7-17(24)13-11(19-16(17)23)5-4-6-12(13)20(14)3/h4-6,9-10,14,21,24H,7-8H2,1-3H3,(H,18,22)(H,19,23)/t10-,14-,17+/m0/s1 |
| InChIKey | QJKOTTLCVZMZOP-RMLVOYDJSA-N |
| XLogP | 0.17 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |