C21H14F13N — CID 102094256
1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)methanimine (PubChem CID 102094256) has the molecular formula C21H14F13N and a molecular weight of 527.32 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)methanimine.
| Compound Name | 1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)methanimine |
|---|---|
| PubChem CID | 102094256 |
| Molecular Formula | C21H14F13N |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)methanimine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC/N=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14F13N/c22-16(23,17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)34)10-11-35-12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9,12H,10-11H2/b35-12+ |
| InChIKey | FCWMDKJZFNMPLG-RHQFVSDJSA-N |
| XLogP | 7.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|