About 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one
9-chlorobenzo[f][1,2,3]benzodithiazol-4-one (PubChem CID 102094781) has the molecular formula C10H4ClNOS2
and a molecular weight of 253.74 g/mol. Its IUPAC name is 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one.
Molecular Properties
| Compound Name | 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one |
| PubChem CID | 102094781 |
| Molecular Formula | C10H4ClNOS2 |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 252.94 |
| IUPAC Name | 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one |
| SMILES | O=c1c2nssc-2c(Cl)c2ccccc12 |
| InChI | InChI=1S/C10H4ClNOS2/c11-7-5-3-1-2-4-6(5)9(13)8-10(7)14-15-12-8/h1-4H |
| InChIKey | NAXXTORZJVEHRJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one?
The IUPAC name of 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one (CID 102094781) is 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one.
What is the SMILES notation for 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one?
The canonical SMILES for 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one is O=c1c2nssc-2c(Cl)c2ccccc12.
What is the InChIKey of 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one?
The InChIKey is NAXXTORZJVEHRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4ClNOS2/c11-7-5-3-1-2-4-6(5)9(13)8-10(7)14-15-12-8/h1-4H.
What are the key properties of 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one?
9-chlorobenzo[f][1,2,3]benzodithiazol-4-one has a molecular weight of 253.74 g/mol, XLogP of 3.48, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chlorobenzo[f][1,2,3]benzodithiazol-4-one is sourced from PubChem (CID 102094781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).