C17H15F17O — CID 102095187
2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)bicyclo[2.2.1]heptane (PubChem CID 102095187) has the molecular formula C17H15F17O and a molecular weight of 558.27 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)bicyclo[2.2.1]heptane.
| Compound Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 102095187 |
| Molecular Formula | C17H15F17O |
| Molecular Weight | 558.27 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)bicyclo[2.2.1]heptane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC1CC2CCC1C2 |
| InChI | InChI=1S/C17H15F17O/c18-10(19,3-4-35-9-6-7-1-2-8(9)5-7)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h7-9H,1-6H2 |
| InChIKey | VHXRTLOMPJKLSD-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.27 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|