C8H9NO2 — CID 102095284
(1E,3E,5E)-1-nitroocta-1,3,5,7-tetraene (PubChem CID 102095284) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is (1E,3E,5E)-1-nitroocta-1,3,5,7-tetraene.
| Compound Name | (1E,3E,5E)-1-nitroocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 102095284 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (1E,3E,5E)-1-nitroocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C/C=C/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C8H9NO2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H,1H2/b4-3+,6-5+,8-7+ |
| InChIKey | SPPRTBZVBQGXJW-ARQDATDDSA-N |
| XLogP | 2.08 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|