C12H10F12O2S — CID 102095385
6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-5-methoxythian-3-one (PubChem CID 102095385) has the molecular formula C12H10F12O2S and a molecular weight of 446.25 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-5-methoxythian-3-one.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-5-methoxythian-3-one |
|---|---|
| PubChem CID | 102095385 |
| Molecular Formula | C12H10F12O2S |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-5-methoxythian-3-one |
| SMILES | COC1CC(=O)CSC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H10F12O2S/c1-26-5-2-4(25)3-27-6(5)8(15,16)10(19,20)12(23,24)11(21,22)9(17,18)7(13)14/h5-7H,2-3H2,1H3 |
| InChIKey | TUXNKEUWJDFKHX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|