C25H27ClF3N5O2S — CID 10209554
1-[4-[[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 10209554) has the molecular formula C25H27ClF3N5O2S and a molecular weight of 554.04 g/mol. Its IUPAC name is 1-[4-[[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-[[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 10209554 |
| Molecular Formula | C25H27ClF3N5O2S |
| Molecular Weight | 554.04 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 1-[4-[[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | COc1ccc(CNc2nc(CN3CCN(C(=O)C(F)(F)F)CC3)nc3sc4c(c23)CCCC4)cc1Cl |
| InChI | InChI=1S/C25H27ClF3N5O2S/c1-36-18-7-6-15(12-17(18)26)13-30-22-21-16-4-2-3-5-19(16)37-23(21)32-20(31-22)14-33-8-10-34(11-9-33)24(35)25(27,28)29/h6-7,12H,2-5,8-11,13-14H2,1H3,(H,30,31,32) |
| InChIKey | WFIGPSZPSIIENQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.04 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |