C11H12Cl3N2O8P — CID 102095543
1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-oxo-2-(2,2,2-trichloroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]pyrimidine-2,4-dione (PubChem CID 102095543) has the molecular formula C11H12Cl3N2O8P and a molecular weight of 437.56 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-oxo-2-(2,2,2-trichloroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-oxo-2-(2,2,2-trichloroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102095543 |
| Molecular Formula | C11H12Cl3N2O8P |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-oxo-2-(2,2,2-trichloroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@H]3OP(=O)(OCC(Cl)(Cl)Cl)O[C@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C11H12Cl3N2O8P/c12-11(13,14)4-21-25(20)23-7-5(3-17)22-9(8(7)24-25)16-2-1-6(18)15-10(16)19/h1-2,5,7-9,17H,3-4H2,(H,15,18,19)/t5-,7-,8-,9-,25?/m1/s1 |
| InChIKey | KHSZXTFRFNWXFV-RZRFIKHHSA-N |
| XLogP | 0.71 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|