C31H38O7S — CID 10209590
phenacyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate (PubChem CID 10209590) has the molecular formula C31H38O7S and a molecular weight of 554.71 g/mol. Its IUPAC name is phenacyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate.
| Compound Name | phenacyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 10209590 |
| Molecular Formula | C31H38O7S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | phenacyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
| SMILES | COCc1cccc(C[C@H](O)/C=C/[C@H]2[C@H](O)CC(=O)[C@@H]2CCSCCCC(=O)OCC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H38O7S/c1-37-20-23-8-5-7-22(17-23)18-25(32)12-13-26-27(29(34)19-28(26)33)14-16-39-15-6-11-31(36)38-21-30(35)24-9-3-2-4-10-24/h2-5,7-10,12-13,17,25-28,32-33H,6,11,14-16,18-21H2,1H3/b13-12+/t25-,26-,27-,28-/m1/s1 |
| InChIKey | IIZCLASNTSGCSX-YLVVOMCGSA-N |
| XLogP | 4.19 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|