C14H18N2O2Se — CID 102096570
methyl (4R,5R)-4-(dimethylamino)-2-phenyl-5,6-dihydro-4H-1,3-selenazine-5-carboxylate (PubChem CID 102096570) has the molecular formula C14H18N2O2Se and a molecular weight of 325.27 g/mol. Its IUPAC name is methyl (4R,5R)-4-(dimethylamino)-2-phenyl-5,6-dihydro-4H-1,3-selenazine-5-carboxylate.
| Compound Name | methyl (4R,5R)-4-(dimethylamino)-2-phenyl-5,6-dihydro-4H-1,3-selenazine-5-carboxylate |
|---|---|
| PubChem CID | 102096570 |
| Molecular Formula | C14H18N2O2Se |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | methyl (4R,5R)-4-(dimethylamino)-2-phenyl-5,6-dihydro-4H-1,3-selenazine-5-carboxylate |
| SMILES | COC(=O)[C@@H]1C[Se]C(c2ccccc2)=N[C@H]1N(C)C |
| InChI | InChI=1S/C14H18N2O2Se/c1-16(2)12-11(14(17)18-3)9-19-13(15-12)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | CXOPVGDJZASHAI-NEPJUHHUSA-N |
| XLogP | 1.25 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|