About (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile
(E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile (PubChem CID 102096697) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile.
Molecular Properties
| Compound Name | (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile |
| PubChem CID | 102096697 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile |
| SMILES | CC(C)(O)CCC(C)(C)/C=C/C#N |
| InChI | InChI=1S/C11H19NO/c1-10(2,6-5-9-12)7-8-11(3,4)13/h5-6,13H,7-8H2,1-4H3/b6-5+ |
| InChIKey | XEOBWFDWOJQSIE-AATRIKPKSA-N |
| XLogP | 2.64 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile?
The IUPAC name of (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile (CID 102096697) is (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile.
What is the SMILES notation for (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile?
The canonical SMILES for (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile is CC(C)(O)CCC(C)(C)/C=C/C#N.
What is the InChIKey of (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile?
The InChIKey is XEOBWFDWOJQSIE-AATRIKPKSA-N. The full InChI is InChI=1S/C11H19NO/c1-10(2,6-5-9-12)7-8-11(3,4)13/h5-6,13H,7-8H2,1-4H3/b6-5+.
What are the key properties of (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile?
(E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile has a molecular weight of 181.28 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-hydroxy-4,4,7-trimethyloct-2-enenitrile is sourced from PubChem (CID 102096697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).