C30H36N6O3 — CID 102097010
(1S,2S,6S,7S,8R,12S)-5-(2,4-dimethylphenyl)-10-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 102097010) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is (1S,2S,6S,7S,8R,12S)-5-(2,4-dimethylphenyl)-10-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1S,2S,6S,7S,8R,12S)-5-(2,4-dimethylphenyl)-10-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 102097010 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | (1S,2S,6S,7S,8R,12S)-5-(2,4-dimethylphenyl)-10-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | Cc1ccc(C2=NO[C@H]3[C@H]4C[C@@H]([C@@H]23)[C@H]2C(=O)N(CCCCN3CCN(c5ncccn5)CC3)C(=O)[C@@H]42)c(C)c1 |
| InChI | InChI=1S/C30H36N6O3/c1-18-6-7-20(19(2)16-18)26-25-21-17-22(27(25)39-33-26)24-23(21)28(37)36(29(24)38)11-4-3-10-34-12-14-35(15-13-34)30-31-8-5-9-32-30/h5-9,16,21-25,27H,3-4,10-15,17H2,1-2H3/t21-,22+,23-,24+,25+,27+/m1/s1 |
| InChIKey | YNGRYLXWXCVKGV-WADPJWBESA-N |
| XLogP | 2.67 |
| TPSA | 91.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|