C24H34B2N2O2 — CID 102097094
3-[2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 102097094) has the molecular formula C24H34B2N2O2 and a molecular weight of 404.17 g/mol. Its IUPAC name is 3-[2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-[2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 102097094 |
| Molecular Formula | C24H34B2N2O2 |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 3-[2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | CC1(C)OB(C(CC2CCCCC2)B2Nc3cccc4cccc(c34)N2)OC1(C)C |
| InChI | InChI=1S/C24H34B2N2O2/c1-23(2)24(3,4)30-26(29-23)21(16-17-10-6-5-7-11-17)25-27-19-14-8-12-18-13-9-15-20(28-25)22(18)19/h8-9,12-15,17,21,27-28H,5-7,10-11,16H2,1-4H3 |
| InChIKey | BGJMLOBMGGIHHQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|