C21H28NO6PS — CID 102097356
N-[(2R)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 102097356) has the molecular formula C21H28NO6PS and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[(2R)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(2R)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 102097356 |
| Molecular Formula | C21H28NO6PS |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[(2R)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | COP(=O)(CC(=O)[C@@H](Cc1ccccc1)NS(=O)(=O)c1c(C)cc(C)cc1C)OC |
| InChI | InChI=1S/C21H28NO6PS/c1-15-11-16(2)21(17(3)12-15)30(25,26)22-19(13-18-9-7-6-8-10-18)20(23)14-29(24,27-4)28-5/h6-12,19,22H,13-14H2,1-5H3/t19-/m1/s1 |
| InChIKey | MOLXYBLGTKBBNV-LJQANCHMSA-N |
| XLogP | 3.56 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|