C72H54N4O6S3 — CID 102097666
4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]-N,N-bis[4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]phenyl]aniline (PubChem CID 102097666) has the molecular formula C72H54N4O6S3 and a molecular weight of 1167.45 g/mol. Its IUPAC name is 4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]-N,N-bis[4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]phenyl]aniline.
| Compound Name | 4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]-N,N-bis[4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 102097666 |
| Molecular Formula | C72H54N4O6S3 |
| Molecular Weight | 1167.45 g/mol |
| Exact Mass | 1166.32 |
| IUPAC Name | 4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]-N,N-bis[4-[5-(3,6-dimethoxycarbazol-9-yl)thiophen-2-yl]phenyl]aniline |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1ccc(-c2ccc(N(c3ccc(-c4ccc(-n5c6ccc(OC)cc6c6cc(OC)ccc65)s4)cc3)c3ccc(-c4ccc(-n5c6ccc(OC)cc6c6cc(OC)ccc65)s4)cc3)cc2)s1 |
| InChI | InChI=1S/C72H54N4O6S3/c1-77-49-19-25-61-55(37-49)56-38-50(78-2)20-26-62(56)74(61)70-34-31-67(83-70)43-7-13-46(14-8-43)73(47-15-9-44(10-16-47)68-32-35-71(84-68)75-63-27-21-51(79-3)39-57(63)58-40-52(80-4)22-28-64(58)75)48-17-11-45(12-18-48)69-33-36-72(85-69)76-65-29-23-53(81-5)41-59(65)60-42-54(82-6)24-30-66(60)76/h7-42H,1-6H3 |
| InChIKey | BKFMYILJYYPJOB-UHFFFAOYSA-N |
| XLogP | 19.68 |
| TPSA | 73.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.45 |
| LogP ≤ 5 | 19.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |